C20H29O10P — CID 89108859
[(2S,4R,5R)-4-acetyloxy-5-(diethoxyphosphorylmethoxy)-2-(hydroxymethyl)-3-methyloxolan-3-yl] benzoate (PubChem CID 89108859) has the molecular formula C20H29O10P and a molecular weight of 460.42 g/mol. Its IUPAC name is [(2S,4R,5R)-4-acetyloxy-5-(diethoxyphosphorylmethoxy)-2-(hydroxymethyl)-3-methyloxolan-3-yl] benzoate.
| Compound Name | [(2S,4R,5R)-4-acetyloxy-5-(diethoxyphosphorylmethoxy)-2-(hydroxymethyl)-3-methyloxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 89108859 |
| Molecular Formula | C20H29O10P |
| Molecular Weight | 460.42 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | [(2S,4R,5R)-4-acetyloxy-5-(diethoxyphosphorylmethoxy)-2-(hydroxymethyl)-3-methyloxolan-3-yl] benzoate |
| SMILES | CCOP(=O)(CO[C@H]1O[C@@H](CO)C(C)(OC(=O)c2ccccc2)[C@H]1OC(C)=O)OCC |
| InChI | InChI=1S/C20H29O10P/c1-5-26-31(24,27-6-2)13-25-19-17(28-14(3)22)20(4,16(12-21)29-19)30-18(23)15-10-8-7-9-11-15/h7-11,16-17,19,21H,5-6,12-13H2,1-4H3/t16-,17-,19-,20?/m0/s1 |
| InChIKey | BLJWCUYFAXGJGF-NTNVKXBTSA-N |
| XLogP | 2.49 |
| TPSA | 126.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.42 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|