About (3E)-3-[2-(2-propoxyethoxy)ethoxy]hexa-1,3,5-trien-2-amine
(3E)-3-[2-(2-propoxyethoxy)ethoxy]hexa-1,3,5-trien-2-amine (PubChem CID 89109088) has the molecular formula C13H23NO3
and a molecular weight of 241.33 g/mol. Its IUPAC name is (3E)-3-[2-(2-propoxyethoxy)ethoxy]hexa-1,3,5-trien-2-amine.
Molecular Properties
| Compound Name | (3E)-3-[2-(2-propoxyethoxy)ethoxy]hexa-1,3,5-trien-2-amine |
| PubChem CID | 89109088 |
| Molecular Formula | C13H23NO3 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.17 |
| IUPAC Name | (3E)-3-[2-(2-propoxyethoxy)ethoxy]hexa-1,3,5-trien-2-amine |
| SMILES | C=C/C=C(/OCCOCCOCCC)C(=C)N |
| InChI | InChI=1S/C13H23NO3/c1-4-6-13(12(3)14)17-11-10-16-9-8-15-7-5-2/h4,6H,1,3,5,7-11,14H2,2H3/b13-6+ |
| InChIKey | IWTJHKYCMVAYBE-AWNIVKPZSA-N |
| XLogP | 1.99 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E)-3-[2-(2-propoxyethoxy)ethoxy]hexa-1,3,5-trien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-3-[2-(2-propoxyethoxy)ethoxy]hexa-1,3,5-trien-2-amine?
The IUPAC name of (3E)-3-[2-(2-propoxyethoxy)ethoxy]hexa-1,3,5-trien-2-amine (CID 89109088) is (3E)-3-[2-(2-propoxyethoxy)ethoxy]hexa-1,3,5-trien-2-amine.
What is the SMILES notation for (3E)-3-[2-(2-propoxyethoxy)ethoxy]hexa-1,3,5-trien-2-amine?
The canonical SMILES for (3E)-3-[2-(2-propoxyethoxy)ethoxy]hexa-1,3,5-trien-2-amine is C=C/C=C(/OCCOCCOCCC)C(=C)N.
What is the InChIKey of (3E)-3-[2-(2-propoxyethoxy)ethoxy]hexa-1,3,5-trien-2-amine?
The InChIKey is IWTJHKYCMVAYBE-AWNIVKPZSA-N. The full InChI is InChI=1S/C13H23NO3/c1-4-6-13(12(3)14)17-11-10-16-9-8-15-7-5-2/h4,6H,1,3,5,7-11,14H2,2H3/b13-6+.
What are the key properties of (3E)-3-[2-(2-propoxyethoxy)ethoxy]hexa-1,3,5-trien-2-amine?
(3E)-3-[2-(2-propoxyethoxy)ethoxy]hexa-1,3,5-trien-2-amine has a molecular weight of 241.33 g/mol, XLogP of 1.99, 11 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-3-[2-(2-propoxyethoxy)ethoxy]hexa-1,3,5-trien-2-amine is sourced from PubChem (CID 89109088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).