About 5-ethyl-2,3-dihydro-1,3-benzothiazole
5-ethyl-2,3-dihydro-1,3-benzothiazole (PubChem CID 89109120) has the molecular formula C9H11NS
and a molecular weight of 165.26 g/mol. Its IUPAC name is 5-ethyl-2,3-dihydro-1,3-benzothiazole.
Molecular Properties
| Compound Name | 5-ethyl-2,3-dihydro-1,3-benzothiazole |
| PubChem CID | 89109120 |
| Molecular Formula | C9H11NS |
| Molecular Weight | 165.26 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | 5-ethyl-2,3-dihydro-1,3-benzothiazole |
| SMILES | CCc1ccc2c(c1)NCS2 |
| InChI | InChI=1S/C9H11NS/c1-2-7-3-4-9-8(5-7)10-6-11-9/h3-5,10H,2,6H2,1H3 |
| InChIKey | FLCJIYUZDXXMKY-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.26 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-ethyl-2,3-dihydro-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-2,3-dihydro-1,3-benzothiazole?
The IUPAC name of 5-ethyl-2,3-dihydro-1,3-benzothiazole (CID 89109120) is 5-ethyl-2,3-dihydro-1,3-benzothiazole.
What is the SMILES notation for 5-ethyl-2,3-dihydro-1,3-benzothiazole?
The canonical SMILES for 5-ethyl-2,3-dihydro-1,3-benzothiazole is CCc1ccc2c(c1)NCS2.
What is the InChIKey of 5-ethyl-2,3-dihydro-1,3-benzothiazole?
The InChIKey is FLCJIYUZDXXMKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NS/c1-2-7-3-4-9-8(5-7)10-6-11-9/h3-5,10H,2,6H2,1H3.
What are the key properties of 5-ethyl-2,3-dihydro-1,3-benzothiazole?
5-ethyl-2,3-dihydro-1,3-benzothiazole has a molecular weight of 165.26 g/mol, XLogP of 2.72, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-2,3-dihydro-1,3-benzothiazole is sourced from PubChem (CID 89109120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).