C10H13NO2 — CID 89109319
(1R,2R,6S,7S)-4-methyl-4-azatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 89109319) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is (1R,2R,6S,7S)-4-methyl-4-azatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (1R,2R,6S,7S)-4-methyl-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 89109319 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | (1R,2R,6S,7S)-4-methyl-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | CN1C(=O)[C@@H]2[C@@H]3CC[C@@H](C3)[C@@H]2C1=O |
| InChI | InChI=1S/C10H13NO2/c1-11-9(12)7-5-2-3-6(4-5)8(7)10(11)13/h5-8H,2-4H2,1H3/t5-,6+,7-,8+ |
| InChIKey | NDFOKPXSRHTKGQ-KVFPUHGPSA-N |
| XLogP | 0.65 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|