C26H30F2N8O — CID 89109454
5-[4-[[1-(5-ethylpyrimidin-2-yl)piperidin-4-yl]methoxy]-3,5-difluorophenyl]-N'-[methyl-(methylideneamino)amino]pyridine-2-carboximidamide (PubChem CID 89109454) has the molecular formula C26H30F2N8O and a molecular weight of 508.58 g/mol. Its IUPAC name is 5-[4-[[1-(5-ethylpyrimidin-2-yl)piperidin-4-yl]methoxy]-3,5-difluorophenyl]-N'-[methyl-(methylideneamino)amino]pyridine-2-carboximidamide.
| Compound Name | 5-[4-[[1-(5-ethylpyrimidin-2-yl)piperidin-4-yl]methoxy]-3,5-difluorophenyl]-N'-[methyl-(methylideneamino)amino]pyridine-2-carboximidamide |
|---|---|
| PubChem CID | 89109454 |
| Molecular Formula | C26H30F2N8O |
| Molecular Weight | 508.58 g/mol |
| Exact Mass | 508.25 |
| IUPAC Name | 5-[4-[[1-(5-ethylpyrimidin-2-yl)piperidin-4-yl]methoxy]-3,5-difluorophenyl]-N'-[methyl-(methylideneamino)amino]pyridine-2-carboximidamide |
| SMILES | C=NN(C)/N=C(\N)c1ccc(-c2cc(F)c(OCC3CCN(c4ncc(CC)cn4)CC3)c(F)c2)cn1 |
| InChI | InChI=1S/C26H30F2N8O/c1-4-17-13-32-26(33-14-17)36-9-7-18(8-10-36)16-37-24-21(27)11-20(12-22(24)28)19-5-6-23(31-15-19)25(29)34-35(3)30-2/h5-6,11-15,18H,2,4,7-10,16H2,1,3H3,(H2,29,34) |
| InChIKey | XGRRVDNRLHPBCZ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 105.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.58 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|