C22H30FN3O2 — CID 89109473
4-[3-[1-[(1E,3E)-1-amino-4-fluorohexa-1,3,5-trienyl]piperidin-4-yl]propoxy]-2-methylbenzamide (PubChem CID 89109473) has the molecular formula C22H30FN3O2 and a molecular weight of 387.50 g/mol. Its IUPAC name is 4-[3-[1-[(1E,3E)-1-amino-4-fluorohexa-1,3,5-trienyl]piperidin-4-yl]propoxy]-2-methylbenzamide.
| Compound Name | 4-[3-[1-[(1E,3E)-1-amino-4-fluorohexa-1,3,5-trienyl]piperidin-4-yl]propoxy]-2-methylbenzamide |
|---|---|
| PubChem CID | 89109473 |
| Molecular Formula | C22H30FN3O2 |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | 4-[3-[1-[(1E,3E)-1-amino-4-fluorohexa-1,3,5-trienyl]piperidin-4-yl]propoxy]-2-methylbenzamide |
| SMILES | C=C/C(F)=C\C=C(/N)N1CCC(CCCOc2ccc(C(N)=O)c(C)c2)CC1 |
| InChI | InChI=1S/C22H30FN3O2/c1-3-18(23)6-9-21(24)26-12-10-17(11-13-26)5-4-14-28-19-7-8-20(22(25)27)16(2)15-19/h3,6-9,15,17H,1,4-5,10-14,24H2,2H3,(H2,25,27)/b18-6+,21-9+ |
| InChIKey | DFLDXHBRBPJOSZ-NHGGOLEFSA-N |
| XLogP | 3.80 |
| TPSA | 81.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|