C14H30O3Si — CID 89109520
(2R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-ethylhexanoic acid (PubChem CID 89109520) has the molecular formula C14H30O3Si and a molecular weight of 274.48 g/mol. Its IUPAC name is (2R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-ethylhexanoic acid.
| Compound Name | (2R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-ethylhexanoic acid |
|---|---|
| PubChem CID | 89109520 |
| Molecular Formula | C14H30O3Si |
| Molecular Weight | 274.48 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | (2R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-ethylhexanoic acid |
| SMILES | CC[C@@H](C[C@@H](CC)C(=O)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H30O3Si/c1-8-11(13(15)16)10-12(9-2)17-18(6,7)14(3,4)5/h11-12H,8-10H2,1-7H3,(H,15,16)/t11-,12+/m1/s1 |
| InChIKey | IQPKPFGEKGIIEO-NEPJUHHUSA-N |
| XLogP | 4.29 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.48 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|