C21H37N3 — CID 89109626
2-N-[2-[(2S,6S)-1-[(2S)-heptan-2-yl]-6-methylpiperidin-2-yl]ethyl]benzene-1,2-diamine (PubChem CID 89109626) has the molecular formula C21H37N3 and a molecular weight of 331.55 g/mol. Its IUPAC name is 2-N-[2-[(2S,6S)-1-[(2S)-heptan-2-yl]-6-methylpiperidin-2-yl]ethyl]benzene-1,2-diamine.
| Compound Name | 2-N-[2-[(2S,6S)-1-[(2S)-heptan-2-yl]-6-methylpiperidin-2-yl]ethyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 89109626 |
| Molecular Formula | C21H37N3 |
| Molecular Weight | 331.55 g/mol |
| Exact Mass | 331.30 |
| IUPAC Name | 2-N-[2-[(2S,6S)-1-[(2S)-heptan-2-yl]-6-methylpiperidin-2-yl]ethyl]benzene-1,2-diamine |
| SMILES | CCCCC[C@H](C)N1[C@H](CCNc2ccccc2N)CCC[C@@H]1C |
| InChI | InChI=1S/C21H37N3/c1-4-5-6-10-17(2)24-18(3)11-9-12-19(24)15-16-23-21-14-8-7-13-20(21)22/h7-8,13-14,17-19,23H,4-6,9-12,15-16,22H2,1-3H3/t17-,18-,19-/m0/s1 |
| InChIKey | UAJOQYIWEITRCN-FHWLQOOXSA-N |
| XLogP | 5.28 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.55 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|