About (E)-N-tert-butyl-2,2-difluoro-5,5-dimethylhex-3-en-1-amine
(E)-N-tert-butyl-2,2-difluoro-5,5-dimethylhex-3-en-1-amine (PubChem CID 89109632) has the molecular formula C12H23F2N
and a molecular weight of 219.32 g/mol. Its IUPAC name is (E)-N-tert-butyl-2,2-difluoro-5,5-dimethylhex-3-en-1-amine.
Molecular Properties
| Compound Name | (E)-N-tert-butyl-2,2-difluoro-5,5-dimethylhex-3-en-1-amine |
| PubChem CID | 89109632 |
| Molecular Formula | C12H23F2N |
| Molecular Weight | 219.32 g/mol |
| Exact Mass | 219.18 |
| IUPAC Name | (E)-N-tert-butyl-2,2-difluoro-5,5-dimethylhex-3-en-1-amine |
| SMILES | CC(C)(C)/C=C/C(F)(F)CNC(C)(C)C |
| InChI | InChI=1S/C12H23F2N/c1-10(2,3)7-8-12(13,14)9-15-11(4,5)6/h7-8,15H,9H2,1-6H3/b8-7+ |
| InChIKey | RHJPHUYQLVJTAF-BQYQJAHWSA-N |
| XLogP | 3.61 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.32 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-tert-butyl-2,2-difluoro-5,5-dimethylhex-3-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-tert-butyl-2,2-difluoro-5,5-dimethylhex-3-en-1-amine?
The IUPAC name of (E)-N-tert-butyl-2,2-difluoro-5,5-dimethylhex-3-en-1-amine (CID 89109632) is (E)-N-tert-butyl-2,2-difluoro-5,5-dimethylhex-3-en-1-amine.
What is the SMILES notation for (E)-N-tert-butyl-2,2-difluoro-5,5-dimethylhex-3-en-1-amine?
The canonical SMILES for (E)-N-tert-butyl-2,2-difluoro-5,5-dimethylhex-3-en-1-amine is CC(C)(C)/C=C/C(F)(F)CNC(C)(C)C.
What is the InChIKey of (E)-N-tert-butyl-2,2-difluoro-5,5-dimethylhex-3-en-1-amine?
The InChIKey is RHJPHUYQLVJTAF-BQYQJAHWSA-N. The full InChI is InChI=1S/C12H23F2N/c1-10(2,3)7-8-12(13,14)9-15-11(4,5)6/h7-8,15H,9H2,1-6H3/b8-7+.
What are the key properties of (E)-N-tert-butyl-2,2-difluoro-5,5-dimethylhex-3-en-1-amine?
(E)-N-tert-butyl-2,2-difluoro-5,5-dimethylhex-3-en-1-amine has a molecular weight of 219.32 g/mol, XLogP of 3.61, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-tert-butyl-2,2-difluoro-5,5-dimethylhex-3-en-1-amine is sourced from PubChem (CID 89109632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).