C12H19NO — CID 89109781
6-ethyl-7-methoxy-1,2,3,4,4a,8a-hexahydroisoquinoline (PubChem CID 89109781) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is 6-ethyl-7-methoxy-1,2,3,4,4a,8a-hexahydroisoquinoline.
| Compound Name | 6-ethyl-7-methoxy-1,2,3,4,4a,8a-hexahydroisoquinoline |
|---|---|
| PubChem CID | 89109781 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 6-ethyl-7-methoxy-1,2,3,4,4a,8a-hexahydroisoquinoline |
| SMILES | CCC1=CC2CCNCC2C=C1OC |
| InChI | InChI=1S/C12H19NO/c1-3-9-6-10-4-5-13-8-11(10)7-12(9)14-2/h6-7,10-11,13H,3-5,8H2,1-2H3 |
| InChIKey | YADBCNSDKXJBFF-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |