C24H43Cl3O7Si — CID 89109812
[(4S,5S,6R,9S)-11,11-dihydroxy-4,6,8,8-tetramethyl-7-oxo-9-triethylsilyloxyundec-1-en-5-yl] 2,2,2-trichloroethyl carbonate (PubChem CID 89109812) has the molecular formula C24H43Cl3O7Si and a molecular weight of 578.05 g/mol. Its IUPAC name is [(4S,5S,6R,9S)-11,11-dihydroxy-4,6,8,8-tetramethyl-7-oxo-9-triethylsilyloxyundec-1-en-5-yl] 2,2,2-trichloroethyl carbonate.
| Compound Name | [(4S,5S,6R,9S)-11,11-dihydroxy-4,6,8,8-tetramethyl-7-oxo-9-triethylsilyloxyundec-1-en-5-yl] 2,2,2-trichloroethyl carbonate |
|---|---|
| PubChem CID | 89109812 |
| Molecular Formula | C24H43Cl3O7Si |
| Molecular Weight | 578.05 g/mol |
| Exact Mass | 576.18 |
| IUPAC Name | [(4S,5S,6R,9S)-11,11-dihydroxy-4,6,8,8-tetramethyl-7-oxo-9-triethylsilyloxyundec-1-en-5-yl] 2,2,2-trichloroethyl carbonate |
| SMILES | C=CC[C@H](C)[C@H](OC(=O)OCC(Cl)(Cl)Cl)[C@@H](C)C(=O)C(C)(C)[C@H](CC(O)O)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C24H43Cl3O7Si/c1-9-13-16(5)20(33-22(31)32-15-24(25,26)27)17(6)21(30)23(7,8)18(14-19(28)29)34-35(10-2,11-3)12-4/h9,16-20,28-29H,1,10-15H2,2-8H3/t16-,17+,18-,20-/m0/s1 |
| InChIKey | RSIIJMVUQHHNCP-DMUMMCEESA-N |
| XLogP | 6.41 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.05 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|