About 4,6-dimethyl-2,3-dihydrodibenzofuran
4,6-dimethyl-2,3-dihydrodibenzofuran (PubChem CID 89109853) has the molecular formula C14H14O
and a molecular weight of 198.26 g/mol. Its IUPAC name is 4,6-dimethyl-2,3-dihydrodibenzofuran.
Molecular Properties
| Compound Name | 4,6-dimethyl-2,3-dihydrodibenzofuran |
| PubChem CID | 89109853 |
| Molecular Formula | C14H14O |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | 4,6-dimethyl-2,3-dihydrodibenzofuran |
| SMILES | CC1=c2oc3c(C)cccc3c2=CCC1 |
| InChI | InChI=1S/C14H14O/c1-9-5-3-7-11-12-8-4-6-10(2)14(12)15-13(9)11/h3,5,7-8H,4,6H2,1-2H3 |
| InChIKey | QLDSQYLURPXRGV-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4,6-dimethyl-2,3-dihydrodibenzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dimethyl-2,3-dihydrodibenzofuran?
The IUPAC name of 4,6-dimethyl-2,3-dihydrodibenzofuran (CID 89109853) is 4,6-dimethyl-2,3-dihydrodibenzofuran.
What is the SMILES notation for 4,6-dimethyl-2,3-dihydrodibenzofuran?
The canonical SMILES for 4,6-dimethyl-2,3-dihydrodibenzofuran is CC1=c2oc3c(C)cccc3c2=CCC1.
What is the InChIKey of 4,6-dimethyl-2,3-dihydrodibenzofuran?
The InChIKey is QLDSQYLURPXRGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14O/c1-9-5-3-7-11-12-8-4-6-10(2)14(12)15-13(9)11/h3,5,7-8H,4,6H2,1-2H3.
What are the key properties of 4,6-dimethyl-2,3-dihydrodibenzofuran?
4,6-dimethyl-2,3-dihydrodibenzofuran has a molecular weight of 198.26 g/mol, XLogP of 2.49, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dimethyl-2,3-dihydrodibenzofuran is sourced from PubChem (CID 89109853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).