C24H35F3O6 — CID 89109855
[(5E)-2-oxo-6-(trifluoromethyl)nona-5,8-dien-3-yl] (3S,6R,7S)-3,7-dihydroxy-4,4,6,8-tetramethyl-5-oxodec-9-enoate (PubChem CID 89109855) has the molecular formula C24H35F3O6 and a molecular weight of 476.53 g/mol. Its IUPAC name is [(5E)-2-oxo-6-(trifluoromethyl)nona-5,8-dien-3-yl] (3S,6R,7S)-3,7-dihydroxy-4,4,6,8-tetramethyl-5-oxodec-9-enoate.
| Compound Name | [(5E)-2-oxo-6-(trifluoromethyl)nona-5,8-dien-3-yl] (3S,6R,7S)-3,7-dihydroxy-4,4,6,8-tetramethyl-5-oxodec-9-enoate |
|---|---|
| PubChem CID | 89109855 |
| Molecular Formula | C24H35F3O6 |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | [(5E)-2-oxo-6-(trifluoromethyl)nona-5,8-dien-3-yl] (3S,6R,7S)-3,7-dihydroxy-4,4,6,8-tetramethyl-5-oxodec-9-enoate |
| SMILES | C=CC/C(=C\CC(OC(=O)C[C@H](O)C(C)(C)C(=O)[C@H](C)[C@@H](O)C(C)C=C)C(C)=O)C(F)(F)F |
| InChI | InChI=1S/C24H35F3O6/c1-8-10-17(24(25,26)27)11-12-18(16(5)28)33-20(30)13-19(29)23(6,7)22(32)15(4)21(31)14(3)9-2/h8-9,11,14-15,18-19,21,29,31H,1-2,10,12-13H2,3-7H3/b17-11+/t14?,15-,18?,19+,21+/m1/s1 |
| InChIKey | ATZKWZORAUSXDZ-XONLFONBSA-N |
| XLogP | 4.11 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|