C20H16Cl2 — CID 89109864
2,7-dichloro-4,5,9,10-tetramethylpyrene (PubChem CID 89109864) has the molecular formula C20H16Cl2 and a molecular weight of 327.25 g/mol. Its IUPAC name is 2,7-dichloro-4,5,9,10-tetramethylpyrene.
| Compound Name | 2,7-dichloro-4,5,9,10-tetramethylpyrene |
|---|---|
| PubChem CID | 89109864 |
| Molecular Formula | C20H16Cl2 |
| Molecular Weight | 327.25 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | 2,7-dichloro-4,5,9,10-tetramethylpyrene |
| SMILES | Cc1c(C)c2cc(Cl)cc3c(C)c(C)c4cc(Cl)cc1c4c23 |
| InChI | InChI=1S/C20H16Cl2/c1-9-10(2)16-6-14(22)8-18-12(4)11(3)17-7-13(21)5-15(9)19(17)20(16)18/h5-8H,1-4H3 |
| InChIKey | KWPOOLGYCHMVQJ-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.25 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|