About (8R)-3-(2-fluoropropan-2-yl)tricyclo[5.2.1.03,8]decane
(8R)-3-(2-fluoropropan-2-yl)tricyclo[5.2.1.03,8]decane (PubChem CID 89109996) has the molecular formula C13H21F
and a molecular weight of 196.31 g/mol. Its IUPAC name is (8R)-3-(2-fluoropropan-2-yl)tricyclo[5.2.1.03,8]decane.
Molecular Properties
| Compound Name | (8R)-3-(2-fluoropropan-2-yl)tricyclo[5.2.1.03,8]decane |
| PubChem CID | 89109996 |
| Molecular Formula | C13H21F |
| Molecular Weight | 196.31 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | (8R)-3-(2-fluoropropan-2-yl)tricyclo[5.2.1.03,8]decane |
| SMILES | CC(C)(F)C12CCCC3CC(CC31)C2 |
| InChI | InChI=1S/C13H21F/c1-12(2,14)13-5-3-4-10-6-9(8-13)7-11(10)13/h9-11H,3-8H2,1-2H3 |
| InChIKey | UAYCEKLTLGYJHY-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.31 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (8R)-3-(2-fluoropropan-2-yl)tricyclo[5.2.1.03,8]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8R)-3-(2-fluoropropan-2-yl)tricyclo[5.2.1.03,8]decane?
The IUPAC name of (8R)-3-(2-fluoropropan-2-yl)tricyclo[5.2.1.03,8]decane (CID 89109996) is (8R)-3-(2-fluoropropan-2-yl)tricyclo[5.2.1.03,8]decane.
What is the SMILES notation for (8R)-3-(2-fluoropropan-2-yl)tricyclo[5.2.1.03,8]decane?
The canonical SMILES for (8R)-3-(2-fluoropropan-2-yl)tricyclo[5.2.1.03,8]decane is CC(C)(F)C12CCCC3CC(CC31)C2.
What is the InChIKey of (8R)-3-(2-fluoropropan-2-yl)tricyclo[5.2.1.03,8]decane?
The InChIKey is UAYCEKLTLGYJHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21F/c1-12(2,14)13-5-3-4-10-6-9(8-13)7-11(10)13/h9-11H,3-8H2,1-2H3.
What are the key properties of (8R)-3-(2-fluoropropan-2-yl)tricyclo[5.2.1.03,8]decane?
(8R)-3-(2-fluoropropan-2-yl)tricyclo[5.2.1.03,8]decane has a molecular weight of 196.31 g/mol, XLogP of 3.95, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (8R)-3-(2-fluoropropan-2-yl)tricyclo[5.2.1.03,8]decane is sourced from PubChem (CID 89109996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).