C21H24ClF2N3O3S — CID 89110198
(5Z)-5-[[3-chloro-5-(1,1-difluoroethyl)-2-(4-morpholin-4-ylpiperidin-1-yl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 89110198) has the molecular formula C21H24ClF2N3O3S and a molecular weight of 471.96 g/mol. Its IUPAC name is (5Z)-5-[[3-chloro-5-(1,1-difluoroethyl)-2-(4-morpholin-4-ylpiperidin-1-yl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[3-chloro-5-(1,1-difluoroethyl)-2-(4-morpholin-4-ylpiperidin-1-yl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 89110198 |
| Molecular Formula | C21H24ClF2N3O3S |
| Molecular Weight | 471.96 g/mol |
| Exact Mass | 471.12 |
| IUPAC Name | (5Z)-5-[[3-chloro-5-(1,1-difluoroethyl)-2-(4-morpholin-4-ylpiperidin-1-yl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CC(F)(F)c1cc(Cl)c(N2CCC(N3CCOCC3)CC2)c(/C=C2\SC(=O)NC2=O)c1 |
| InChI | InChI=1S/C21H24ClF2N3O3S/c1-21(23,24)14-10-13(11-17-19(28)25-20(29)31-17)18(16(22)12-14)27-4-2-15(3-5-27)26-6-8-30-9-7-26/h10-12,15H,2-9H2,1H3,(H,25,28,29)/b17-11- |
| InChIKey | YMTSDGICXNNHCD-BOPFTXTBSA-N |
| XLogP | 4.08 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.96 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|