C64H58N10 — CID 89110234
6-[1-[4,6-bis(2-methyl-N-(2-methylphenyl)anilino)-1,3,5-triazin-2-yl]ethenyl]-2-N,2-N,4-N,4-N-tetrakis(2-methylphenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 89110234) has the molecular formula C64H58N10 and a molecular weight of 967.24 g/mol. Its IUPAC name is 6-[1-[4,6-bis(2-methyl-N-(2-methylphenyl)anilino)-1,3,5-triazin-2-yl]ethenyl]-2-N,2-N,4-N,4-N-tetrakis(2-methylphenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[1-[4,6-bis(2-methyl-N-(2-methylphenyl)anilino)-1,3,5-triazin-2-yl]ethenyl]-2-N,2-N,4-N,4-N-tetrakis(2-methylphenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 89110234 |
| Molecular Formula | C64H58N10 |
| Molecular Weight | 967.24 g/mol |
| Exact Mass | 966.48 |
| IUPAC Name | 6-[1-[4,6-bis(2-methyl-N-(2-methylphenyl)anilino)-1,3,5-triazin-2-yl]ethenyl]-2-N,2-N,4-N,4-N-tetrakis(2-methylphenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | C=C(c1nc(N(c2ccccc2C)c2ccccc2C)nc(N(c2ccccc2C)c2ccccc2C)n1)c1nc(N(c2ccccc2C)c2ccccc2C)nc(N(c2ccccc2C)c2ccccc2C)n1 |
| InChI | InChI=1S/C64H58N10/c1-42-26-10-18-34-51(42)71(52-35-19-11-27-43(52)2)61-65-59(66-62(69-61)72(53-36-20-12-28-44(53)3)54-37-21-13-29-45(54)4)50(9)60-67-63(73(55-38-22-14-30-46(55)5)56-39-23-15-31-47(56)6)70-64(68-60)74(57-40-24-16-32-48(57)7)58-41-25-17-33-49(58)8/h10-41H,9H2,1-8H3 |
| InChIKey | WVZQELQGODMEHH-UHFFFAOYSA-N |
| XLogP | 16.46 |
| TPSA | 90.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 967.24 |
| LogP ≤ 5 | 16.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |