C32H18F4N6 — CID 89110340
2-[1-[4,6-bis(4-fluorophenyl)-1,3,5-triazin-2-yl]ethenyl]-4,6-bis(4-fluorophenyl)-1,3,5-triazine (PubChem CID 89110340) has the molecular formula C32H18F4N6 and a molecular weight of 562.53 g/mol. Its IUPAC name is 2-[1-[4,6-bis(4-fluorophenyl)-1,3,5-triazin-2-yl]ethenyl]-4,6-bis(4-fluorophenyl)-1,3,5-triazine.
| Compound Name | 2-[1-[4,6-bis(4-fluorophenyl)-1,3,5-triazin-2-yl]ethenyl]-4,6-bis(4-fluorophenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 89110340 |
| Molecular Formula | C32H18F4N6 |
| Molecular Weight | 562.53 g/mol |
| Exact Mass | 562.15 |
| IUPAC Name | 2-[1-[4,6-bis(4-fluorophenyl)-1,3,5-triazin-2-yl]ethenyl]-4,6-bis(4-fluorophenyl)-1,3,5-triazine |
| SMILES | C=C(c1nc(-c2ccc(F)cc2)nc(-c2ccc(F)cc2)n1)c1nc(-c2ccc(F)cc2)nc(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C32H18F4N6/c1-18(27-37-29(19-2-10-23(33)11-3-19)41-30(38-27)20-4-12-24(34)13-5-20)28-39-31(21-6-14-25(35)15-7-21)42-32(40-28)22-8-16-26(36)17-9-22/h2-17H,1H2 |
| InChIKey | QHOQQGXXDVSHCS-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.53 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |