C11H15NO — CID 89110450
7-(methylamino)-1,2,3,4-tetrahydronaphthalen-1-ol (PubChem CID 89110450) has the molecular formula C11H15NO and a molecular weight of 177.25 g/mol. Its IUPAC name is 7-(methylamino)-1,2,3,4-tetrahydronaphthalen-1-ol.
| Compound Name | 7-(methylamino)-1,2,3,4-tetrahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 89110450 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | 7-(methylamino)-1,2,3,4-tetrahydronaphthalen-1-ol |
| SMILES | CNc1ccc2c(c1)C(O)CCC2 |
| InChI | InChI=1S/C11H15NO/c1-12-9-6-5-8-3-2-4-11(13)10(8)7-9/h5-7,11-13H,2-4H2,1H3 |
| InChIKey | KYIHILPKVNYISJ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |