C15H17ClN5O3+ — CID 89110655
2-amino-4-chloro-7-[(1-hydroxy-4-methoxy-3,5-dimethylpyridin-1-ium-2-yl)methyl]-5H-pyrrolo[2,3-d]pyrimidin-6-one (PubChem CID 89110655) has the molecular formula C15H17ClN5O3+ and a molecular weight of 350.79 g/mol. Its IUPAC name is 2-amino-4-chloro-7-[(1-hydroxy-4-methoxy-3,5-dimethylpyridin-1-ium-2-yl)methyl]-5H-pyrrolo[2,3-d]pyrimidin-6-one.
| Compound Name | 2-amino-4-chloro-7-[(1-hydroxy-4-methoxy-3,5-dimethylpyridin-1-ium-2-yl)methyl]-5H-pyrrolo[2,3-d]pyrimidin-6-one |
|---|---|
| PubChem CID | 89110655 |
| Molecular Formula | C15H17ClN5O3+ |
| Molecular Weight | 350.79 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | 2-amino-4-chloro-7-[(1-hydroxy-4-methoxy-3,5-dimethylpyridin-1-ium-2-yl)methyl]-5H-pyrrolo[2,3-d]pyrimidin-6-one |
| SMILES | COc1c(C)c[n+](O)c(CN2C(=O)Cc3c(Cl)nc(N)nc32)c1C |
| InChI | InChI=1S/C15H17ClN5O3/c1-7-5-21(23)10(8(2)12(7)24-3)6-20-11(22)4-9-13(16)18-15(17)19-14(9)20/h5,23H,4,6H2,1-3H3,(H2,17,18,19)/q+1 |
| InChIKey | PHYBTJHGXXIDRQ-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.79 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|