C70H56N4 — CID 89111108
5-[9,10-bis(9,9-dimethylfluoren-2-yl)-6-(10-methyl-1,2-dihydrophenazin-5-yl)anthracen-2-yl]-10-methylphenazine (PubChem CID 89111108) has the molecular formula C70H56N4 and a molecular weight of 953.25 g/mol. Its IUPAC name is 5-[9,10-bis(9,9-dimethylfluoren-2-yl)-6-(10-methyl-1,2-dihydrophenazin-5-yl)anthracen-2-yl]-10-methylphenazine.
| Compound Name | 5-[9,10-bis(9,9-dimethylfluoren-2-yl)-6-(10-methyl-1,2-dihydrophenazin-5-yl)anthracen-2-yl]-10-methylphenazine |
|---|---|
| PubChem CID | 89111108 |
| Molecular Formula | C70H56N4 |
| Molecular Weight | 953.25 g/mol |
| Exact Mass | 952.45 |
| IUPAC Name | 5-[9,10-bis(9,9-dimethylfluoren-2-yl)-6-(10-methyl-1,2-dihydrophenazin-5-yl)anthracen-2-yl]-10-methylphenazine |
| SMILES | CN1C2=C(C=CCC2)N(c2ccc3c(-c4ccc5c(c4)C(C)(C)c4ccccc4-5)c4cc(N5c6ccccc6N(C)c6ccccc65)ccc4c(-c4ccc5c(c4)C(C)(C)c4ccccc4-5)c3c2)c2ccccc21 |
| InChI | InChI=1S/C70H56N4/c1-69(2)55-21-9-7-19-47(55)49-35-31-43(39-57(49)69)67-51-37-33-46(74-65-29-17-13-25-61(65)72(6)62-26-14-18-30-66(62)74)42-54(51)68(44-32-36-50-48-20-8-10-22-56(48)70(3,4)58(50)40-44)52-38-34-45(41-53(52)67)73-63-27-15-11-23-59(63)71(5)60-24-12-16-28-64(60)73/h7-13,15-25,27-42H,14,26H2,1-6H3 |
| InChIKey | VHKJYCNPKQUWJM-UHFFFAOYSA-N |
| XLogP | 18.64 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 953.25 |
| LogP ≤ 5 | 18.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|