About 4-methoxy-1,4-dihydroquinazoline
4-methoxy-1,4-dihydroquinazoline (PubChem CID 89111836) has the molecular formula C9H10N2O
and a molecular weight of 162.19 g/mol. Its IUPAC name is 4-methoxy-1,4-dihydroquinazoline.
Molecular Properties
| Compound Name | 4-methoxy-1,4-dihydroquinazoline |
| PubChem CID | 89111836 |
| Molecular Formula | C9H10N2O |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | 4-methoxy-1,4-dihydroquinazoline |
| SMILES | COC1N=CNc2ccccc21 |
| InChI | InChI=1S/C9H10N2O/c1-12-9-7-4-2-3-5-8(7)10-6-11-9/h2-6,9H,1H3,(H,10,11) |
| InChIKey | AUUKEODWWHHRPB-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methoxy-1,4-dihydroquinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-1,4-dihydroquinazoline?
The IUPAC name of 4-methoxy-1,4-dihydroquinazoline (CID 89111836) is 4-methoxy-1,4-dihydroquinazoline.
What is the SMILES notation for 4-methoxy-1,4-dihydroquinazoline?
The canonical SMILES for 4-methoxy-1,4-dihydroquinazoline is COC1N=CNc2ccccc21.
What is the InChIKey of 4-methoxy-1,4-dihydroquinazoline?
The InChIKey is AUUKEODWWHHRPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O/c1-12-9-7-4-2-3-5-8(7)10-6-11-9/h2-6,9H,1H3,(H,10,11).
What are the key properties of 4-methoxy-1,4-dihydroquinazoline?
4-methoxy-1,4-dihydroquinazoline has a molecular weight of 162.19 g/mol, XLogP of 1.79, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-1,4-dihydroquinazoline is sourced from PubChem (CID 89111836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).