C20H21N3O5S — CID 89112112
(2R,3R)-2,3-dihydroxy-N-[2-[4-[(2-methylquinolin-4-yl)oxymethyl]-1,3-thiazol-2-yl]ethyl]-4-oxobutanamide (PubChem CID 89112112) has the molecular formula C20H21N3O5S and a molecular weight of 415.47 g/mol. Its IUPAC name is (2R,3R)-2,3-dihydroxy-N-[2-[4-[(2-methylquinolin-4-yl)oxymethyl]-1,3-thiazol-2-yl]ethyl]-4-oxobutanamide.
| Compound Name | (2R,3R)-2,3-dihydroxy-N-[2-[4-[(2-methylquinolin-4-yl)oxymethyl]-1,3-thiazol-2-yl]ethyl]-4-oxobutanamide |
|---|---|
| PubChem CID | 89112112 |
| Molecular Formula | C20H21N3O5S |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | (2R,3R)-2,3-dihydroxy-N-[2-[4-[(2-methylquinolin-4-yl)oxymethyl]-1,3-thiazol-2-yl]ethyl]-4-oxobutanamide |
| SMILES | Cc1cc(OCc2csc(CCNC(=O)[C@H](O)[C@@H](O)C=O)n2)c2ccccc2n1 |
| InChI | InChI=1S/C20H21N3O5S/c1-12-8-17(14-4-2-3-5-15(14)22-12)28-10-13-11-29-18(23-13)6-7-21-20(27)19(26)16(25)9-24/h2-5,8-9,11,16,19,25-26H,6-7,10H2,1H3,(H,21,27)/t16-,19+/m0/s1 |
| InChIKey | TZKKBACWRBXABP-QFBILLFUSA-N |
| XLogP | 1.16 |
| TPSA | 121.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|