About (2E,4E)-4-amino-5-(methylamino)penta-2,4-dienal
(2E,4E)-4-amino-5-(methylamino)penta-2,4-dienal (PubChem CID 89112575) has the molecular formula C6H10N2O
and a molecular weight of 126.16 g/mol. Its IUPAC name is (2E,4E)-4-amino-5-(methylamino)penta-2,4-dienal.
Molecular Properties
| Compound Name | (2E,4E)-4-amino-5-(methylamino)penta-2,4-dienal |
| PubChem CID | 89112575 |
| Molecular Formula | C6H10N2O |
| Molecular Weight | 126.16 g/mol |
| Exact Mass | 126.08 |
| IUPAC Name | (2E,4E)-4-amino-5-(methylamino)penta-2,4-dienal |
| SMILES | CN/C=C(N)\C=C\C=O |
| InChI | InChI=1S/C6H10N2O/c1-8-5-6(7)3-2-4-9/h2-5,8H,7H2,1H3/b3-2+,6-5+ |
| InChIKey | ORBNNQQBEVQITM-ZIMISOLQSA-N |
| XLogP | -0.24 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.16 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E,4E)-4-amino-5-(methylamino)penta-2,4-dienal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,4E)-4-amino-5-(methylamino)penta-2,4-dienal?
The IUPAC name of (2E,4E)-4-amino-5-(methylamino)penta-2,4-dienal (CID 89112575) is (2E,4E)-4-amino-5-(methylamino)penta-2,4-dienal.
What is the SMILES notation for (2E,4E)-4-amino-5-(methylamino)penta-2,4-dienal?
The canonical SMILES for (2E,4E)-4-amino-5-(methylamino)penta-2,4-dienal is CN/C=C(N)\C=C\C=O.
What is the InChIKey of (2E,4E)-4-amino-5-(methylamino)penta-2,4-dienal?
The InChIKey is ORBNNQQBEVQITM-ZIMISOLQSA-N. The full InChI is InChI=1S/C6H10N2O/c1-8-5-6(7)3-2-4-9/h2-5,8H,7H2,1H3/b3-2+,6-5+.
What are the key properties of (2E,4E)-4-amino-5-(methylamino)penta-2,4-dienal?
(2E,4E)-4-amino-5-(methylamino)penta-2,4-dienal has a molecular weight of 126.16 g/mol, XLogP of -0.24, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4E)-4-amino-5-(methylamino)penta-2,4-dienal is sourced from PubChem (CID 89112575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).