C10H16O — CID 89112583
1,4,4a,5,6,7,8,8a-octahydronaphthalen-1-ol (PubChem CID 89112583) has the molecular formula C10H16O and a molecular weight of 152.24 g/mol. Its IUPAC name is 1,4,4a,5,6,7,8,8a-octahydronaphthalen-1-ol.
| Compound Name | 1,4,4a,5,6,7,8,8a-octahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 89112583 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | 1,4,4a,5,6,7,8,8a-octahydronaphthalen-1-ol |
| SMILES | OC1C=CCC2CCCCC12 |
| InChI | InChI=1S/C10H16O/c11-10-7-3-5-8-4-1-2-6-9(8)10/h3,7-11H,1-2,4-6H2 |
| InChIKey | ANWGKODGMICTRO-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|