C8H11FIN — CID 89112659
(2E,4E,6E)-7-fluoro-5-iodoocta-2,4,6-trien-2-amine (PubChem CID 89112659) has the molecular formula C8H11FIN and a molecular weight of 267.08 g/mol. Its IUPAC name is (2E,4E,6E)-7-fluoro-5-iodoocta-2,4,6-trien-2-amine.
| Compound Name | (2E,4E,6E)-7-fluoro-5-iodoocta-2,4,6-trien-2-amine |
|---|---|
| PubChem CID | 89112659 |
| Molecular Formula | C8H11FIN |
| Molecular Weight | 267.08 g/mol |
| Exact Mass | 266.99 |
| IUPAC Name | (2E,4E,6E)-7-fluoro-5-iodoocta-2,4,6-trien-2-amine |
| SMILES | C/C(N)=C\C=C(I)/C=C(\C)F |
| InChI | InChI=1S/C8H11FIN/c1-6(9)5-8(10)4-3-7(2)11/h3-5H,11H2,1-2H3/b6-5+,7-3+,8-4+ |
| InChIKey | SCBJDRQMYSWJNF-PTKURJLQSA-N |
| XLogP | 3.04 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.08 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|