About 4-[1-[(1-aminocyclopropyl)methyl]piperidin-4-yl]-2,5-dimethylaniline
4-[1-[(1-aminocyclopropyl)methyl]piperidin-4-yl]-2,5-dimethylaniline (PubChem CID 89112708) has the molecular formula C17H27N3
and a molecular weight of 273.42 g/mol. Its IUPAC name is 4-[1-[(1-aminocyclopropyl)methyl]piperidin-4-yl]-2,5-dimethylaniline.
Molecular Properties
| Compound Name | 4-[1-[(1-aminocyclopropyl)methyl]piperidin-4-yl]-2,5-dimethylaniline |
| PubChem CID | 89112708 |
| Molecular Formula | C17H27N3 |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.22 |
| IUPAC Name | 4-[1-[(1-aminocyclopropyl)methyl]piperidin-4-yl]-2,5-dimethylaniline |
| SMILES | Cc1cc(C2CCN(CC3(N)CC3)CC2)c(C)cc1N |
| InChI | InChI=1S/C17H27N3/c1-12-10-16(18)13(2)9-15(12)14-3-7-20(8-4-14)11-17(19)5-6-17/h9-10,14H,3-8,11,18-19H2,1-2H3 |
| InChIKey | HDWMZFAINTVMAC-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-[1-[(1-aminocyclopropyl)methyl]piperidin-4-yl]-2,5-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-[(1-aminocyclopropyl)methyl]piperidin-4-yl]-2,5-dimethylaniline?
The IUPAC name of 4-[1-[(1-aminocyclopropyl)methyl]piperidin-4-yl]-2,5-dimethylaniline (CID 89112708) is 4-[1-[(1-aminocyclopropyl)methyl]piperidin-4-yl]-2,5-dimethylaniline.
What is the SMILES notation for 4-[1-[(1-aminocyclopropyl)methyl]piperidin-4-yl]-2,5-dimethylaniline?
The canonical SMILES for 4-[1-[(1-aminocyclopropyl)methyl]piperidin-4-yl]-2,5-dimethylaniline is Cc1cc(C2CCN(CC3(N)CC3)CC2)c(C)cc1N.
What is the InChIKey of 4-[1-[(1-aminocyclopropyl)methyl]piperidin-4-yl]-2,5-dimethylaniline?
The InChIKey is HDWMZFAINTVMAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27N3/c1-12-10-16(18)13(2)9-15(12)14-3-7-20(8-4-14)11-17(19)5-6-17/h9-10,14H,3-8,11,18-19H2,1-2H3.
What are the key properties of 4-[1-[(1-aminocyclopropyl)methyl]piperidin-4-yl]-2,5-dimethylaniline?
4-[1-[(1-aminocyclopropyl)methyl]piperidin-4-yl]-2,5-dimethylaniline has a molecular weight of 273.42 g/mol, XLogP of 2.56, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-[(1-aminocyclopropyl)methyl]piperidin-4-yl]-2,5-dimethylaniline is sourced from PubChem (CID 89112708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).