C18H26N4O — CID 89112807
4-[1-[(3-ethyl-1,2,4-oxadiazol-5-yl)methyl]piperidin-4-yl]-2,5-dimethylaniline (PubChem CID 89112807) has the molecular formula C18H26N4O and a molecular weight of 314.43 g/mol. Its IUPAC name is 4-[1-[(3-ethyl-1,2,4-oxadiazol-5-yl)methyl]piperidin-4-yl]-2,5-dimethylaniline.
| Compound Name | 4-[1-[(3-ethyl-1,2,4-oxadiazol-5-yl)methyl]piperidin-4-yl]-2,5-dimethylaniline |
|---|---|
| PubChem CID | 89112807 |
| Molecular Formula | C18H26N4O |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | 4-[1-[(3-ethyl-1,2,4-oxadiazol-5-yl)methyl]piperidin-4-yl]-2,5-dimethylaniline |
| SMILES | CCc1noc(CN2CCC(c3cc(C)c(N)cc3C)CC2)n1 |
| InChI | InChI=1S/C18H26N4O/c1-4-17-20-18(23-21-17)11-22-7-5-14(6-8-22)15-9-13(3)16(19)10-12(15)2/h9-10,14H,4-8,11,19H2,1-3H3 |
| InChIKey | MDWZWFWOPIWBBQ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|