C22H19F3N4O3S — CID 89113043
2-[4-(3-hydroxypropoxy)-2-(trifluoromethyl)phenyl]-N-(5-methyl-1,3-thiazol-2-yl)-1H-benzimidazole-4-carboxamide (PubChem CID 89113043) has the molecular formula C22H19F3N4O3S and a molecular weight of 476.48 g/mol. Its IUPAC name is 2-[4-(3-hydroxypropoxy)-2-(trifluoromethyl)phenyl]-N-(5-methyl-1,3-thiazol-2-yl)-1H-benzimidazole-4-carboxamide.
| Compound Name | 2-[4-(3-hydroxypropoxy)-2-(trifluoromethyl)phenyl]-N-(5-methyl-1,3-thiazol-2-yl)-1H-benzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 89113043 |
| Molecular Formula | C22H19F3N4O3S |
| Molecular Weight | 476.48 g/mol |
| Exact Mass | 476.11 |
| IUPAC Name | 2-[4-(3-hydroxypropoxy)-2-(trifluoromethyl)phenyl]-N-(5-methyl-1,3-thiazol-2-yl)-1H-benzimidazole-4-carboxamide |
| SMILES | Cc1cnc(NC(=O)c2cccc3[nH]c(-c4ccc(OCCCO)cc4C(F)(F)F)nc23)s1 |
| InChI | InChI=1S/C22H19F3N4O3S/c1-12-11-26-21(33-12)29-20(31)15-4-2-5-17-18(15)28-19(27-17)14-7-6-13(32-9-3-8-30)10-16(14)22(23,24)25/h2,4-7,10-11,30H,3,8-9H2,1H3,(H,27,28)(H,26,29,31) |
| InChIKey | TTYYVKQEJAKIDZ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.48 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|