C33H37NO2SSi — CID 89113221
tert-butyl N-[[3-methyl-4-(2-triphenylsilylsulfanylethyl)phenyl]methyl]carbamate (PubChem CID 89113221) has the molecular formula C33H37NO2SSi and a molecular weight of 539.82 g/mol. Its IUPAC name is tert-butyl N-[[3-methyl-4-(2-triphenylsilylsulfanylethyl)phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[3-methyl-4-(2-triphenylsilylsulfanylethyl)phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 89113221 |
| Molecular Formula | C33H37NO2SSi |
| Molecular Weight | 539.82 g/mol |
| Exact Mass | 539.23 |
| IUPAC Name | tert-butyl N-[[3-methyl-4-(2-triphenylsilylsulfanylethyl)phenyl]methyl]carbamate |
| SMILES | Cc1cc(CNC(=O)OC(C)(C)C)ccc1CCS[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H37NO2SSi/c1-26-24-27(25-34-32(35)36-33(2,3)4)20-21-28(26)22-23-37-38(29-14-8-5-9-15-29,30-16-10-6-11-17-30)31-18-12-7-13-19-31/h5-21,24H,22-23,25H2,1-4H3,(H,34,35) |
| InChIKey | HGNIVWIYBKTHPR-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.82 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|