About S-(4-fluorophenyl) 2,2-dimethylpropanethioate
S-(4-fluorophenyl) 2,2-dimethylpropanethioate (PubChem CID 89113248) has the molecular formula C11H13FOS
and a molecular weight of 212.29 g/mol. Its IUPAC name is S-(4-fluorophenyl) 2,2-dimethylpropanethioate.
Molecular Properties
| Compound Name | S-(4-fluorophenyl) 2,2-dimethylpropanethioate |
| PubChem CID | 89113248 |
| Molecular Formula | C11H13FOS |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | S-(4-fluorophenyl) 2,2-dimethylpropanethioate |
| SMILES | CC(C)(C)C(=O)Sc1ccc(F)cc1 |
| InChI | InChI=1S/C11H13FOS/c1-11(2,3)10(13)14-9-6-4-8(12)5-7-9/h4-7H,1-3H3 |
| InChIKey | LFQHLXOGPPUOKQ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(4-fluorophenyl) 2,2-dimethylpropanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(4-fluorophenyl) 2,2-dimethylpropanethioate?
The IUPAC name of S-(4-fluorophenyl) 2,2-dimethylpropanethioate (CID 89113248) is S-(4-fluorophenyl) 2,2-dimethylpropanethioate.
What is the SMILES notation for S-(4-fluorophenyl) 2,2-dimethylpropanethioate?
The canonical SMILES for S-(4-fluorophenyl) 2,2-dimethylpropanethioate is CC(C)(C)C(=O)Sc1ccc(F)cc1.
What is the InChIKey of S-(4-fluorophenyl) 2,2-dimethylpropanethioate?
The InChIKey is LFQHLXOGPPUOKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13FOS/c1-11(2,3)10(13)14-9-6-4-8(12)5-7-9/h4-7H,1-3H3.
What are the key properties of S-(4-fluorophenyl) 2,2-dimethylpropanethioate?
S-(4-fluorophenyl) 2,2-dimethylpropanethioate has a molecular weight of 212.29 g/mol, XLogP of 3.49, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-(4-fluorophenyl) 2,2-dimethylpropanethioate is sourced from PubChem (CID 89113248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).