About (2R,5R)-1-(3-methoxypropyl)-2,5-dimethylpyrrolidine
(2R,5R)-1-(3-methoxypropyl)-2,5-dimethylpyrrolidine (PubChem CID 89113469) has the molecular formula C10H21NO
and a molecular weight of 171.28 g/mol. Its IUPAC name is (2R,5R)-1-(3-methoxypropyl)-2,5-dimethylpyrrolidine.
Molecular Properties
| Compound Name | (2R,5R)-1-(3-methoxypropyl)-2,5-dimethylpyrrolidine |
| PubChem CID | 89113469 |
| Molecular Formula | C10H21NO |
| Molecular Weight | 171.28 g/mol |
| Exact Mass | 171.16 |
| IUPAC Name | (2R,5R)-1-(3-methoxypropyl)-2,5-dimethylpyrrolidine |
| SMILES | COCCCN1[C@H](C)CC[C@H]1C |
| InChI | InChI=1S/C10H21NO/c1-9-5-6-10(2)11(9)7-4-8-12-3/h9-10H,4-8H2,1-3H3/t9-,10-/m1/s1 |
| InChIKey | GAMFQGYUPOJSHF-NXEZZACHSA-N |
| XLogP | 1.90 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.28 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2R,5R)-1-(3-methoxypropyl)-2,5-dimethylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,5R)-1-(3-methoxypropyl)-2,5-dimethylpyrrolidine?
The IUPAC name of (2R,5R)-1-(3-methoxypropyl)-2,5-dimethylpyrrolidine (CID 89113469) is (2R,5R)-1-(3-methoxypropyl)-2,5-dimethylpyrrolidine.
What is the SMILES notation for (2R,5R)-1-(3-methoxypropyl)-2,5-dimethylpyrrolidine?
The canonical SMILES for (2R,5R)-1-(3-methoxypropyl)-2,5-dimethylpyrrolidine is COCCCN1[C@H](C)CC[C@H]1C.
What is the InChIKey of (2R,5R)-1-(3-methoxypropyl)-2,5-dimethylpyrrolidine?
The InChIKey is GAMFQGYUPOJSHF-NXEZZACHSA-N. The full InChI is InChI=1S/C10H21NO/c1-9-5-6-10(2)11(9)7-4-8-12-3/h9-10H,4-8H2,1-3H3/t9-,10-/m1/s1.
What are the key properties of (2R,5R)-1-(3-methoxypropyl)-2,5-dimethylpyrrolidine?
(2R,5R)-1-(3-methoxypropyl)-2,5-dimethylpyrrolidine has a molecular weight of 171.28 g/mol, XLogP of 1.90, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,5R)-1-(3-methoxypropyl)-2,5-dimethylpyrrolidine is sourced from PubChem (CID 89113469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).