C22H27ClN8O5S2 — CID 89113544
2-[(4S)-6-[3-[[2-[(4-chloro-1-methylpyrazol-3-yl)methylamino]phenyl]sulfonylamino]thiophen-2-yl]-4-(hydroxyamino)-5,6-dioxohexyl]guanidine (PubChem CID 89113544) has the molecular formula C22H27ClN8O5S2 and a molecular weight of 583.10 g/mol. Its IUPAC name is 2-[(4S)-6-[3-[[2-[(4-chloro-1-methylpyrazol-3-yl)methylamino]phenyl]sulfonylamino]thiophen-2-yl]-4-(hydroxyamino)-5,6-dioxohexyl]guanidine.
| Compound Name | 2-[(4S)-6-[3-[[2-[(4-chloro-1-methylpyrazol-3-yl)methylamino]phenyl]sulfonylamino]thiophen-2-yl]-4-(hydroxyamino)-5,6-dioxohexyl]guanidine |
|---|---|
| PubChem CID | 89113544 |
| Molecular Formula | C22H27ClN8O5S2 |
| Molecular Weight | 583.10 g/mol |
| Exact Mass | 582.12 |
| IUPAC Name | 2-[(4S)-6-[3-[[2-[(4-chloro-1-methylpyrazol-3-yl)methylamino]phenyl]sulfonylamino]thiophen-2-yl]-4-(hydroxyamino)-5,6-dioxohexyl]guanidine |
| SMILES | Cn1cc(Cl)c(CNc2ccccc2S(=O)(=O)Nc2ccsc2C(=O)C(=O)[C@H](CCCN=C(N)N)NO)n1 |
| InChI | InChI=1S/C22H27ClN8O5S2/c1-31-12-13(23)17(28-31)11-27-14-5-2-3-7-18(14)38(35,36)30-16-8-10-37-21(16)20(33)19(32)15(29-34)6-4-9-26-22(24)25/h2-3,5,7-8,10,12,15,27,29-30,34H,4,6,9,11H2,1H3,(H4,24,25,26)/t15-/m0/s1 |
| InChIKey | XRGBYEOGNRKILD-HNNXBMFYSA-N |
| XLogP | 1.70 |
| TPSA | 206.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.10 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|