C11H17IN2 — CID 89113778
(Z,3E)-3-(2-iodo-1,2-dihydropyrrol-3-ylidene)-4,4-dimethylpent-1-en-1-amine (PubChem CID 89113778) has the molecular formula C11H17IN2 and a molecular weight of 304.18 g/mol. Its IUPAC name is (Z,3E)-3-(2-iodo-1,2-dihydropyrrol-3-ylidene)-4,4-dimethylpent-1-en-1-amine.
| Compound Name | (Z,3E)-3-(2-iodo-1,2-dihydropyrrol-3-ylidene)-4,4-dimethylpent-1-en-1-amine |
|---|---|
| PubChem CID | 89113778 |
| Molecular Formula | C11H17IN2 |
| Molecular Weight | 304.18 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | (Z,3E)-3-(2-iodo-1,2-dihydropyrrol-3-ylidene)-4,4-dimethylpent-1-en-1-amine |
| SMILES | CC(C)(C)C(/C=C\N)=C1\C=CNC1I |
| InChI | InChI=1S/C11H17IN2/c1-11(2,3)9(4-6-13)8-5-7-14-10(8)12/h4-7,10,14H,13H2,1-3H3/b6-4-,9-8+ |
| InChIKey | ZFHGNXPYTKDQKV-LJWGDIBWSA-N |
| XLogP | 2.68 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.18 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|