C15H24O4 — CID 89113906
(1'R,2'R,3'aR,6'aS)-2'-methoxy-5,5-dimethylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-carbaldehyde (PubChem CID 89113906) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is (1'R,2'R,3'aR,6'aS)-2'-methoxy-5,5-dimethylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-carbaldehyde.
| Compound Name | (1'R,2'R,3'aR,6'aS)-2'-methoxy-5,5-dimethylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-carbaldehyde |
|---|---|
| PubChem CID | 89113906 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | (1'R,2'R,3'aR,6'aS)-2'-methoxy-5,5-dimethylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-carbaldehyde |
| SMILES | CO[C@@H]1C[C@@H]2CC3(C[C@@H]2[C@H]1C=O)OCC(C)(C)CO3 |
| InChI | InChI=1S/C15H24O4/c1-14(2)8-18-15(19-9-14)5-10-4-13(17-3)12(7-16)11(10)6-15/h7,10-13H,4-6,8-9H2,1-3H3/t10-,11+,12-,13-/m1/s1 |
| InChIKey | KPPJIJIXADAGDO-YVECIDJPSA-N |
| XLogP | 2.02 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|