C23H36O4 — CID 89113912
(E,3S)-1-[(1'R,2'R,3'aR,6'aS)-2'-methoxy-5,5-dimethylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-yl]-5,5-dideuterio-4-methyloct-1-en-6-yn-3-ol (PubChem CID 89113912) has the molecular formula C23H36O4 and a molecular weight of 378.55 g/mol. Its IUPAC name is (E,3S)-1-[(1'R,2'R,3'aR,6'aS)-2'-methoxy-5,5-dimethylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-yl]-5,5-dideuterio-4-methyloct-1-en-6-yn-3-ol.
| Compound Name | (E,3S)-1-[(1'R,2'R,3'aR,6'aS)-2'-methoxy-5,5-dimethylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-yl]-5,5-dideuterio-4-methyloct-1-en-6-yn-3-ol |
|---|---|
| PubChem CID | 89113912 |
| Molecular Formula | C23H36O4 |
| Molecular Weight | 378.55 g/mol |
| Exact Mass | 378.27 |
| IUPAC Name | (E,3S)-1-[(1'R,2'R,3'aR,6'aS)-2'-methoxy-5,5-dimethylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-yl]-5,5-dideuterio-4-methyloct-1-en-6-yn-3-ol |
| SMILES | [2H]C([2H])(C#CC)C(C)[C@H](O)/C=C/[C@@H]1[C@H]2CC3(C[C@H]2C[C@H]1OC)OCC(C)(C)CO3 |
| InChI | InChI=1S/C23H36O4/c1-6-7-8-16(2)20(24)10-9-18-19-13-23(12-17(19)11-21(18)25-5)26-14-22(3,4)15-27-23/h9-10,16-21,24H,8,11-15H2,1-5H3/b10-9+/t16?,17-,18-,19+,20-,21-/m1/s1/i8D2 |
| InChIKey | VVTIEFCPYRTEQX-RCSZOUDMSA-N |
| XLogP | 3.78 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.55 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|