About 2-phenylmethoxyspiro[8-oxa-2-azabicyclo[3.2.1]oct-6-ene-4,1'-cyclohexane]-3-one
2-phenylmethoxyspiro[8-oxa-2-azabicyclo[3.2.1]oct-6-ene-4,1'-cyclohexane]-3-one (PubChem CID 89114119) has the molecular formula C18H21NO3
and a molecular weight of 299.37 g/mol. Its IUPAC name is 2-phenylmethoxyspiro[8-oxa-2-azabicyclo[3.2.1]oct-6-ene-4,1'-cyclohexane]-3-one.
Molecular Properties
| Compound Name | 2-phenylmethoxyspiro[8-oxa-2-azabicyclo[3.2.1]oct-6-ene-4,1'-cyclohexane]-3-one |
| PubChem CID | 89114119 |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 2-phenylmethoxyspiro[8-oxa-2-azabicyclo[3.2.1]oct-6-ene-4,1'-cyclohexane]-3-one |
| SMILES | O=C1N(OCc2ccccc2)C2C=CC(O2)C12CCCCC2 |
| InChI | InChI=1S/C18H21NO3/c20-17-18(11-5-2-6-12-18)15-9-10-16(22-15)19(17)21-13-14-7-3-1-4-8-14/h1,3-4,7-10,15-16H,2,5-6,11-13H2 |
| InChIKey | LMAITHYDIAQQQK-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylmethoxyspiro[8-oxa-2-azabicyclo[3.2.1]oct-6-ene-4,1'-cyclohexane]-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylmethoxyspiro[8-oxa-2-azabicyclo[3.2.1]oct-6-ene-4,1'-cyclohexane]-3-one?
The IUPAC name of 2-phenylmethoxyspiro[8-oxa-2-azabicyclo[3.2.1]oct-6-ene-4,1'-cyclohexane]-3-one (CID 89114119) is 2-phenylmethoxyspiro[8-oxa-2-azabicyclo[3.2.1]oct-6-ene-4,1'-cyclohexane]-3-one.
What is the SMILES notation for 2-phenylmethoxyspiro[8-oxa-2-azabicyclo[3.2.1]oct-6-ene-4,1'-cyclohexane]-3-one?
The canonical SMILES for 2-phenylmethoxyspiro[8-oxa-2-azabicyclo[3.2.1]oct-6-ene-4,1'-cyclohexane]-3-one is O=C1N(OCc2ccccc2)C2C=CC(O2)C12CCCCC2.
What is the InChIKey of 2-phenylmethoxyspiro[8-oxa-2-azabicyclo[3.2.1]oct-6-ene-4,1'-cyclohexane]-3-one?
The InChIKey is LMAITHYDIAQQQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21NO3/c20-17-18(11-5-2-6-12-18)15-9-10-16(22-15)19(17)21-13-14-7-3-1-4-8-14/h1,3-4,7-10,15-16H,2,5-6,11-13H2.
What are the key properties of 2-phenylmethoxyspiro[8-oxa-2-azabicyclo[3.2.1]oct-6-ene-4,1'-cyclohexane]-3-one?
2-phenylmethoxyspiro[8-oxa-2-azabicyclo[3.2.1]oct-6-ene-4,1'-cyclohexane]-3-one has a molecular weight of 299.37 g/mol, XLogP of 3.19, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylmethoxyspiro[8-oxa-2-azabicyclo[3.2.1]oct-6-ene-4,1'-cyclohexane]-3-one is sourced from PubChem (CID 89114119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).