C11H9F11N2O — CID 89114482
1-[1-(2,2-difluoropropoxy)-1,1,2,2,3,4,5,5,5-nonafluoropentan-3-yl]imidazole (PubChem CID 89114482) has the molecular formula C11H9F11N2O and a molecular weight of 394.18 g/mol. Its IUPAC name is 1-[1-(2,2-difluoropropoxy)-1,1,2,2,3,4,5,5,5-nonafluoropentan-3-yl]imidazole.
| Compound Name | 1-[1-(2,2-difluoropropoxy)-1,1,2,2,3,4,5,5,5-nonafluoropentan-3-yl]imidazole |
|---|---|
| PubChem CID | 89114482 |
| Molecular Formula | C11H9F11N2O |
| Molecular Weight | 394.18 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | 1-[1-(2,2-difluoropropoxy)-1,1,2,2,3,4,5,5,5-nonafluoropentan-3-yl]imidazole |
| SMILES | CC(F)(F)COC(F)(F)C(F)(F)C(F)(C(F)C(F)(F)F)n1ccnc1 |
| InChI | InChI=1S/C11H9F11N2O/c1-7(13,14)4-25-11(21,22)10(19,20)8(15,6(12)9(16,17)18)24-3-2-23-5-24/h2-3,5-6H,4H2,1H3 |
| InChIKey | FLAGDXODKRXEGC-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.18 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|