About 1-(2,2-difluoroethyl)-2,5-dimethylpyridin-4-one
1-(2,2-difluoroethyl)-2,5-dimethylpyridin-4-one (PubChem CID 89114534) has the molecular formula C9H11F2NO
and a molecular weight of 187.19 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-2,5-dimethylpyridin-4-one.
Molecular Properties
| Compound Name | 1-(2,2-difluoroethyl)-2,5-dimethylpyridin-4-one |
| PubChem CID | 89114534 |
| Molecular Formula | C9H11F2NO |
| Molecular Weight | 187.19 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | 1-(2,2-difluoroethyl)-2,5-dimethylpyridin-4-one |
| SMILES | Cc1cn(CC(F)F)c(C)cc1=O |
| InChI | InChI=1S/C9H11F2NO/c1-6-4-12(5-9(10)11)7(2)3-8(6)13/h3-4,9H,5H2,1-2H3 |
| InChIKey | KUHOIMOPSYIHRH-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.19 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(2,2-difluoroethyl)-2,5-dimethylpyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2-difluoroethyl)-2,5-dimethylpyridin-4-one?
The IUPAC name of 1-(2,2-difluoroethyl)-2,5-dimethylpyridin-4-one (CID 89114534) is 1-(2,2-difluoroethyl)-2,5-dimethylpyridin-4-one.
What is the SMILES notation for 1-(2,2-difluoroethyl)-2,5-dimethylpyridin-4-one?
The canonical SMILES for 1-(2,2-difluoroethyl)-2,5-dimethylpyridin-4-one is Cc1cn(CC(F)F)c(C)cc1=O.
What is the InChIKey of 1-(2,2-difluoroethyl)-2,5-dimethylpyridin-4-one?
The InChIKey is KUHOIMOPSYIHRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11F2NO/c1-6-4-12(5-9(10)11)7(2)3-8(6)13/h3-4,9H,5H2,1-2H3.
What are the key properties of 1-(2,2-difluoroethyl)-2,5-dimethylpyridin-4-one?
1-(2,2-difluoroethyl)-2,5-dimethylpyridin-4-one has a molecular weight of 187.19 g/mol, XLogP of 1.73, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2-difluoroethyl)-2,5-dimethylpyridin-4-one is sourced from PubChem (CID 89114534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).