About 5-methylspiro[1,3-dithiane-2,2'-adamantane]
5-methylspiro[1,3-dithiane-2,2'-adamantane] (PubChem CID 89114753) has the molecular formula C14H22S2
and a molecular weight of 254.46 g/mol. Its IUPAC name is 5-methylspiro[1,3-dithiane-2,2'-adamantane].
Molecular Properties
| Compound Name | 5-methylspiro[1,3-dithiane-2,2'-adamantane] |
| PubChem CID | 89114753 |
| Molecular Formula | C14H22S2 |
| Molecular Weight | 254.46 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 5-methylspiro[1,3-dithiane-2,2'-adamantane] |
| SMILES | CC1CSC2(SC1)C1CC3CC(C1)CC2C3 |
| InChI | InChI=1S/C14H22S2/c1-9-7-15-14(16-8-9)12-3-10-2-11(5-12)6-13(14)4-10/h9-13H,2-8H2,1H3 |
| InChIKey | ZGLYFOLYVSFLPU-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.46 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-methylspiro[1,3-dithiane-2,2'-adamantane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylspiro[1,3-dithiane-2,2'-adamantane]?
The IUPAC name of 5-methylspiro[1,3-dithiane-2,2'-adamantane] (CID 89114753) is 5-methylspiro[1,3-dithiane-2,2'-adamantane].
What is the SMILES notation for 5-methylspiro[1,3-dithiane-2,2'-adamantane]?
The canonical SMILES for 5-methylspiro[1,3-dithiane-2,2'-adamantane] is CC1CSC2(SC1)C1CC3CC(C1)CC2C3.
What is the InChIKey of 5-methylspiro[1,3-dithiane-2,2'-adamantane]?
The InChIKey is ZGLYFOLYVSFLPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22S2/c1-9-7-15-14(16-8-9)12-3-10-2-11(5-12)6-13(14)4-10/h9-13H,2-8H2,1H3.
What are the key properties of 5-methylspiro[1,3-dithiane-2,2'-adamantane]?
5-methylspiro[1,3-dithiane-2,2'-adamantane] has a molecular weight of 254.46 g/mol, XLogP of 4.25, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylspiro[1,3-dithiane-2,2'-adamantane] is sourced from PubChem (CID 89114753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).