About [4-[1-(2-phenoxyethoxy)ethoxy]-1-adamantyl]methyl 2,2-difluoropropanoate
[4-[1-(2-phenoxyethoxy)ethoxy]-1-adamantyl]methyl 2,2-difluoropropanoate (PubChem CID 89114795) has the molecular formula C24H32F2O5
and a molecular weight of 438.51 g/mol. Its IUPAC name is [4-[1-(2-phenoxyethoxy)ethoxy]-1-adamantyl]methyl 2,2-difluoropropanoate.
Molecular Properties
| Compound Name | [4-[1-(2-phenoxyethoxy)ethoxy]-1-adamantyl]methyl 2,2-difluoropropanoate |
| PubChem CID | 89114795 |
| Molecular Formula | C24H32F2O5 |
| Molecular Weight | 438.51 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | [4-[1-(2-phenoxyethoxy)ethoxy]-1-adamantyl]methyl 2,2-difluoropropanoate |
| SMILES | CC(OCCOc1ccccc1)OC1C2CC3CC1CC(COC(=O)C(C)(F)F)(C3)C2 |
| InChI | InChI=1S/C24H32F2O5/c1-16(28-8-9-29-20-6-4-3-5-7-20)31-21-18-10-17-11-19(21)14-24(12-17,13-18)15-30-22(27)23(2,25)26/h3-7,16-19,21H,8-15H2,1-2H3 |
| InChIKey | IKIYUMKUQVNLIJ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 438.51 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [4-[1-(2-phenoxyethoxy)ethoxy]-1-adamantyl]methyl 2,2-difluoropropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[1-(2-phenoxyethoxy)ethoxy]-1-adamantyl]methyl 2,2-difluoropropanoate?
The IUPAC name of [4-[1-(2-phenoxyethoxy)ethoxy]-1-adamantyl]methyl 2,2-difluoropropanoate (CID 89114795) is [4-[1-(2-phenoxyethoxy)ethoxy]-1-adamantyl]methyl 2,2-difluoropropanoate.
What is the SMILES notation for [4-[1-(2-phenoxyethoxy)ethoxy]-1-adamantyl]methyl 2,2-difluoropropanoate?
The canonical SMILES for [4-[1-(2-phenoxyethoxy)ethoxy]-1-adamantyl]methyl 2,2-difluoropropanoate is CC(OCCOc1ccccc1)OC1C2CC3CC1CC(COC(=O)C(C)(F)F)(C3)C2.
What is the InChIKey of [4-[1-(2-phenoxyethoxy)ethoxy]-1-adamantyl]methyl 2,2-difluoropropanoate?
The InChIKey is IKIYUMKUQVNLIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H32F2O5/c1-16(28-8-9-29-20-6-4-3-5-7-20)31-21-18-10-17-11-19(21)14-24(12-17,13-18)15-30-22(27)23(2,25)26/h3-7,16-19,21H,8-15H2,1-2H3.
What are the key properties of [4-[1-(2-phenoxyethoxy)ethoxy]-1-adamantyl]methyl 2,2-difluoropropanoate?
[4-[1-(2-phenoxyethoxy)ethoxy]-1-adamantyl]methyl 2,2-difluoropropanoate has a molecular weight of 438.51 g/mol, XLogP of 4.84, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[1-(2-phenoxyethoxy)ethoxy]-1-adamantyl]methyl 2,2-difluoropropanoate is sourced from PubChem (CID 89114795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).