C26H36O3 — CID 89115058
methyl (Z)-4-(1-cyclopropyl-10-ethenyl-2-ethyl-7-oxo-1,3,4,4a,4b,5,6,9,10,10a-decahydrophenanthren-2-yl)but-2-enoate (PubChem CID 89115058) has the molecular formula C26H36O3 and a molecular weight of 396.57 g/mol. Its IUPAC name is methyl (Z)-4-(1-cyclopropyl-10-ethenyl-2-ethyl-7-oxo-1,3,4,4a,4b,5,6,9,10,10a-decahydrophenanthren-2-yl)but-2-enoate.
| Compound Name | methyl (Z)-4-(1-cyclopropyl-10-ethenyl-2-ethyl-7-oxo-1,3,4,4a,4b,5,6,9,10,10a-decahydrophenanthren-2-yl)but-2-enoate |
|---|---|
| PubChem CID | 89115058 |
| Molecular Formula | C26H36O3 |
| Molecular Weight | 396.57 g/mol |
| Exact Mass | 396.27 |
| IUPAC Name | methyl (Z)-4-(1-cyclopropyl-10-ethenyl-2-ethyl-7-oxo-1,3,4,4a,4b,5,6,9,10,10a-decahydrophenanthren-2-yl)but-2-enoate |
| SMILES | C=CC1CC2=CC(=O)CCC2C2CCC(CC)(C/C=C\C(=O)OC)C(C3CC3)C12 |
| InChI | InChI=1S/C26H36O3/c1-4-17-15-19-16-20(27)10-11-21(19)22-12-14-26(5-2,13-6-7-23(28)29-3)25(24(17)22)18-8-9-18/h4,6-7,16-18,21-22,24-25H,1,5,8-15H2,2-3H3/b7-6- |
| InChIKey | RVBOCAFDBFEAIG-SREVYHEPSA-N |
| XLogP | 5.67 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.57 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|