C27H27F3N2O — CID 89115132
17,17,18-trifluoro-1',1',5',5'-tetramethylspiro[16,18-diazapentacyclo[11.7.0.02,10.03,8.015,19]icosa-1(20),2(10),3,5,7,11,13,15(19)-octaene-9,3'-cyclohexane]-12-ol (PubChem CID 89115132) has the molecular formula C27H27F3N2O and a molecular weight of 452.52 g/mol. Its IUPAC name is 17,17,18-trifluoro-1',1',5',5'-tetramethylspiro[16,18-diazapentacyclo[11.7.0.02,10.03,8.015,19]icosa-1(20),2(10),3,5,7,11,13,15(19)-octaene-9,3'-cyclohexane]-12-ol.
| Compound Name | 17,17,18-trifluoro-1',1',5',5'-tetramethylspiro[16,18-diazapentacyclo[11.7.0.02,10.03,8.015,19]icosa-1(20),2(10),3,5,7,11,13,15(19)-octaene-9,3'-cyclohexane]-12-ol |
|---|---|
| PubChem CID | 89115132 |
| Molecular Formula | C27H27F3N2O |
| Molecular Weight | 452.52 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | 17,17,18-trifluoro-1',1',5',5'-tetramethylspiro[16,18-diazapentacyclo[11.7.0.02,10.03,8.015,19]icosa-1(20),2(10),3,5,7,11,13,15(19)-octaene-9,3'-cyclohexane]-12-ol |
| SMILES | CC1(C)CC(C)(C)CC2(C1)c1ccccc1-c1c2cc(O)c2cc3c(cc12)N(F)C(F)(F)N3 |
| InChI | InChI=1S/C27H27F3N2O/c1-24(2)12-25(3,4)14-26(13-24)18-8-6-5-7-15(18)23-17-10-21-20(31-27(28,29)32(21)30)9-16(17)22(33)11-19(23)26/h5-11,31,33H,12-14H2,1-4H3 |
| InChIKey | OEYLQWWRNGMWMY-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.52 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|