C9H9FO3 — CID 89115142
(1R,2R,6R,7S)-2-fluoro-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 89115142) has the molecular formula C9H9FO3 and a molecular weight of 184.17 g/mol. Its IUPAC name is (1R,2R,6R,7S)-2-fluoro-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (1R,2R,6R,7S)-2-fluoro-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 89115142 |
| Molecular Formula | C9H9FO3 |
| Molecular Weight | 184.17 g/mol |
| Exact Mass | 184.05 |
| IUPAC Name | (1R,2R,6R,7S)-2-fluoro-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | O=C1CC(=O)[C@]2(F)[C@H]3CC[C@H](O3)[C@H]12 |
| InChI | InChI=1S/C9H9FO3/c10-9-6(12)3-4(11)8(9)5-1-2-7(9)13-5/h5,7-8H,1-3H2/t5-,7+,8-,9-/m0/s1 |
| InChIKey | FZVIXMZTFQFRTC-VHKYIWFCSA-N |
| XLogP | 0.41 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.17 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|