About (4-methoxyphenyl) 4-(1,3-dioxoisoindol-2-yl)butanoate
(4-methoxyphenyl) 4-(1,3-dioxoisoindol-2-yl)butanoate (PubChem CID 891156) has the molecular formula C19H17NO5
and a molecular weight of 339.35 g/mol. Its IUPAC name is (4-methoxyphenyl) 4-(1,3-dioxoisoindol-2-yl)butanoate.
Molecular Properties
| Compound Name | (4-methoxyphenyl) 4-(1,3-dioxoisoindol-2-yl)butanoate |
| PubChem CID | 891156 |
| Molecular Formula | C19H17NO5 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | (4-methoxyphenyl) 4-(1,3-dioxoisoindol-2-yl)butanoate |
| SMILES | COc1ccc(OC(=O)CCCN2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C19H17NO5/c1-24-13-8-10-14(11-9-13)25-17(21)7-4-12-20-18(22)15-5-2-3-6-16(15)19(20)23/h2-3,5-6,8-11H,4,7,12H2,1H3 |
| InChIKey | LZZMTRDFYVBWGT-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (4-methoxyphenyl) 4-(1,3-dioxoisoindol-2-yl)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methoxyphenyl) 4-(1,3-dioxoisoindol-2-yl)butanoate?
The IUPAC name of (4-methoxyphenyl) 4-(1,3-dioxoisoindol-2-yl)butanoate (CID 891156) is (4-methoxyphenyl) 4-(1,3-dioxoisoindol-2-yl)butanoate.
What is the SMILES notation for (4-methoxyphenyl) 4-(1,3-dioxoisoindol-2-yl)butanoate?
The canonical SMILES for (4-methoxyphenyl) 4-(1,3-dioxoisoindol-2-yl)butanoate is COc1ccc(OC(=O)CCCN2C(=O)c3ccccc3C2=O)cc1.
What is the InChIKey of (4-methoxyphenyl) 4-(1,3-dioxoisoindol-2-yl)butanoate?
The InChIKey is LZZMTRDFYVBWGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17NO5/c1-24-13-8-10-14(11-9-13)25-17(21)7-4-12-20-18(22)15-5-2-3-6-16(15)19(20)23/h2-3,5-6,8-11H,4,7,12H2,1H3.
What are the key properties of (4-methoxyphenyl) 4-(1,3-dioxoisoindol-2-yl)butanoate?
(4-methoxyphenyl) 4-(1,3-dioxoisoindol-2-yl)butanoate has a molecular weight of 339.35 g/mol, XLogP of 2.68, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methoxyphenyl) 4-(1,3-dioxoisoindol-2-yl)butanoate is sourced from PubChem (CID 891156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).