C25H29N5O6S — CID 89115611
2-[6,9-bis(formyloxymethyl)-4-[(4-isothiocyanatophenyl)methyl]-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(14),11(15),12-trien-3-yl]acetic acid (PubChem CID 89115611) has the molecular formula C25H29N5O6S and a molecular weight of 527.60 g/mol. Its IUPAC name is 2-[6,9-bis(formyloxymethyl)-4-[(4-isothiocyanatophenyl)methyl]-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(14),11(15),12-trien-3-yl]acetic acid.
| Compound Name | 2-[6,9-bis(formyloxymethyl)-4-[(4-isothiocyanatophenyl)methyl]-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(14),11(15),12-trien-3-yl]acetic acid |
|---|---|
| PubChem CID | 89115611 |
| Molecular Formula | C25H29N5O6S |
| Molecular Weight | 527.60 g/mol |
| Exact Mass | 527.18 |
| IUPAC Name | 2-[6,9-bis(formyloxymethyl)-4-[(4-isothiocyanatophenyl)methyl]-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(14),11(15),12-trien-3-yl]acetic acid |
| SMILES | O=COCN1CCN(COC=O)CC(Cc2ccc(N=C=S)cc2)N(CC(=O)O)Cc2cccc(n2)C1 |
| InChI | InChI=1S/C25H29N5O6S/c31-18-35-16-28-8-9-29(17-36-19-32)13-24(10-20-4-6-21(7-5-20)26-15-37)30(14-25(33)34)12-23-3-1-2-22(11-28)27-23/h1-7,18-19,24H,8-14,16-17H2,(H,33,34) |
| InChIKey | VRIZKNJLZZHUDO-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 124.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.60 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|