C23H29N5O2S — CID 89115642
2-[(4S)-4-[(4-isothiocyanatophenyl)methyl]-6,9-dimethyl-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(14),11(15),12-trien-3-yl]acetic acid (PubChem CID 89115642) has the molecular formula C23H29N5O2S and a molecular weight of 439.59 g/mol. Its IUPAC name is 2-[(4S)-4-[(4-isothiocyanatophenyl)methyl]-6,9-dimethyl-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(14),11(15),12-trien-3-yl]acetic acid.
| Compound Name | 2-[(4S)-4-[(4-isothiocyanatophenyl)methyl]-6,9-dimethyl-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(14),11(15),12-trien-3-yl]acetic acid |
|---|---|
| PubChem CID | 89115642 |
| Molecular Formula | C23H29N5O2S |
| Molecular Weight | 439.59 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | 2-[(4S)-4-[(4-isothiocyanatophenyl)methyl]-6,9-dimethyl-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(14),11(15),12-trien-3-yl]acetic acid |
| SMILES | CN1CCN(C)C[C@H](Cc2ccc(N=C=S)cc2)N(CC(=O)O)Cc2cccc(n2)C1 |
| InChI | InChI=1S/C23H29N5O2S/c1-26-10-11-27(2)15-22(12-18-6-8-19(9-7-18)24-17-31)28(16-23(29)30)14-21-5-3-4-20(13-26)25-21/h3-9,22H,10-16H2,1-2H3,(H,29,30)/t22-/m0/s1 |
| InChIKey | IKPKCGIQBNHZLL-QFIPXVFZSA-N |
| XLogP | 2.69 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.59 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|