C21H30N4O2 — CID 89115826
2-amino-5-butyl-3-methyl-5-[(3S)-1-(2-phenylacetyl)piperidin-3-yl]imidazol-4-one (PubChem CID 89115826) has the molecular formula C21H30N4O2 and a molecular weight of 370.50 g/mol. Its IUPAC name is 2-amino-5-butyl-3-methyl-5-[(3S)-1-(2-phenylacetyl)piperidin-3-yl]imidazol-4-one.
| Compound Name | 2-amino-5-butyl-3-methyl-5-[(3S)-1-(2-phenylacetyl)piperidin-3-yl]imidazol-4-one |
|---|---|
| PubChem CID | 89115826 |
| Molecular Formula | C21H30N4O2 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | 2-amino-5-butyl-3-methyl-5-[(3S)-1-(2-phenylacetyl)piperidin-3-yl]imidazol-4-one |
| SMILES | CCCCC1([C@H]2CCCN(C(=O)Cc3ccccc3)C2)N=C(N)N(C)C1=O |
| InChI | InChI=1S/C21H30N4O2/c1-3-4-12-21(19(27)24(2)20(22)23-21)17-11-8-13-25(15-17)18(26)14-16-9-6-5-7-10-16/h5-7,9-10,17H,3-4,8,11-15H2,1-2H3,(H2,22,23)/t17-,21?/m0/s1 |
| InChIKey | VCQBCNHYNCOLNM-PBVYKCSPSA-N |
| XLogP | 2.18 |
| TPSA | 79.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |