C15H19N3O — CID 89115923
(5R,6S)-2-amino-3,6-dimethyl-6-phenyl-5-prop-2-enyl-5H-pyrimidin-4-one (PubChem CID 89115923) has the molecular formula C15H19N3O and a molecular weight of 257.34 g/mol. Its IUPAC name is (5R,6S)-2-amino-3,6-dimethyl-6-phenyl-5-prop-2-enyl-5H-pyrimidin-4-one.
| Compound Name | (5R,6S)-2-amino-3,6-dimethyl-6-phenyl-5-prop-2-enyl-5H-pyrimidin-4-one |
|---|---|
| PubChem CID | 89115923 |
| Molecular Formula | C15H19N3O |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | (5R,6S)-2-amino-3,6-dimethyl-6-phenyl-5-prop-2-enyl-5H-pyrimidin-4-one |
| SMILES | C=CC[C@H]1C(=O)N(C)C(N)=N[C@]1(C)c1ccccc1 |
| InChI | InChI=1S/C15H19N3O/c1-4-8-12-13(19)18(3)14(16)17-15(12,2)11-9-6-5-7-10-11/h4-7,9-10,12H,1,8H2,2-3H3,(H2,16,17)/t12-,15+/m0/s1 |
| InChIKey | QJQJNTQODQFCKC-SWLSCSKDSA-N |
| XLogP | 1.88 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|