C14H13F9O6 — CID 89116212
1-O-(1,1,1,3,3,3-hexafluoropropan-2-yl) 4-O-(1,1,1-trifluoropropan-2-yl) 2-(2-methylprop-2-enoyloxy)butanedioate (PubChem CID 89116212) has the molecular formula C14H13F9O6 and a molecular weight of 448.23 g/mol. Its IUPAC name is 1-O-(1,1,1,3,3,3-hexafluoropropan-2-yl) 4-O-(1,1,1-trifluoropropan-2-yl) 2-(2-methylprop-2-enoyloxy)butanedioate.
| Compound Name | 1-O-(1,1,1,3,3,3-hexafluoropropan-2-yl) 4-O-(1,1,1-trifluoropropan-2-yl) 2-(2-methylprop-2-enoyloxy)butanedioate |
|---|---|
| PubChem CID | 89116212 |
| Molecular Formula | C14H13F9O6 |
| Molecular Weight | 448.23 g/mol |
| Exact Mass | 448.06 |
| IUPAC Name | 1-O-(1,1,1,3,3,3-hexafluoropropan-2-yl) 4-O-(1,1,1-trifluoropropan-2-yl) 2-(2-methylprop-2-enoyloxy)butanedioate |
| SMILES | C=C(C)C(=O)OC(CC(=O)OC(C)C(F)(F)F)C(=O)OC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H13F9O6/c1-5(2)9(25)28-7(4-8(24)27-6(3)12(15,16)17)10(26)29-11(13(18,19)20)14(21,22)23/h6-7,11H,1,4H2,2-3H3 |
| InChIKey | KVUBKTJFUYEYKD-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.23 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|